Pomzazed
Hazard to Self
Posts: 57
Registered: 15-9-2008
Location: In th' Lab
Member Is Offline
Mood: Acylated
|
|
heptamethylbenzenium ion
What is the structure of heptamethylbenzenium ion?
The extra methyl is attached to one of the carbon, or it just floats above the aromatic system sharing the electrons just like the hexagonal-based
pyramid shape or what?
I suppose it has many resonance structure just like the norbonyl cation. But is this the case?
Don't stare at me making fumes... I'm just experimenting with some gas...
|
|
|
Nicodem
Super Moderator
Posts: 4230
Registered: 28-12-2004
Member Is Offline
Mood: No Mood
|
|
It's just the sigma complex of hexamethylbenzene with methyl cation. Put this SMILE-s notation in a chemical drawing software if you don't understand
what that is: C\C1=C(/C)C(/C)=C(/C)[C+](C)C1(C)C
(take notion that the charge is delocalized, but unfortunately the SMILE format does not allow it).
|
|
|
![[*]](images/xpblue/default_icon.gif){kind=icon}
